C22H25Cl2N5O2 — CID 123145441
N-[(4-chloro-5-methyl-1H-pyrazol-3-yl)methyl]-4-[2-[[2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]-N-methylbenzamide (PubChem CID 123145441) has the molecular formula C22H25Cl2N5O2 and a molecular weight of 462.38 g/mol. Its IUPAC name is N-[(4-chloro-5-methyl-1H-pyrazol-3-yl)methyl]-4-[2-[[2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]-N-methylbenzamide.
| Compound Name | N-[(4-chloro-5-methyl-1H-pyrazol-3-yl)methyl]-4-[2-[[2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 123145441 |
| Molecular Formula | C22H25Cl2N5O2 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N-[(4-chloro-5-methyl-1H-pyrazol-3-yl)methyl]-4-[2-[[2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]-N-methylbenzamide |
| SMILES | Cc1[nH]nc(CN(C)C(=O)c2ccc(CCNCC(O)c3ccc(Cl)nc3)cc2)c1Cl |
| InChI | InChI=1S/C22H25Cl2N5O2/c1-14-21(24)18(28-27-14)13-29(2)22(31)16-5-3-15(4-6-16)9-10-25-12-19(30)17-7-8-20(23)26-11-17/h3-8,11,19,25,30H,9-10,12-13H2,1-2H3,(H,27,28) |
| InChIKey | PSTQCBHUUGYQQH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|