C23H32ClN3O3 — CID 123775700
4-[2-[[1-(6-chloro-3-pyridinyl)-1-hydroxybutan-2-yl]amino]ethyl]-N-(2-methoxypropyl)-N-methylbenzamide (PubChem CID 123775700) has the molecular formula C23H32ClN3O3 and a molecular weight of 433.98 g/mol. Its IUPAC name is 4-[2-[[1-(6-chloro-3-pyridinyl)-1-hydroxybutan-2-yl]amino]ethyl]-N-(2-methoxypropyl)-N-methylbenzamide.
| Compound Name | 4-[2-[[1-(6-chloro-3-pyridinyl)-1-hydroxybutan-2-yl]amino]ethyl]-N-(2-methoxypropyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 123775700 |
| Molecular Formula | C23H32ClN3O3 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 4-[2-[[1-(6-chloro-3-pyridinyl)-1-hydroxybutan-2-yl]amino]ethyl]-N-(2-methoxypropyl)-N-methylbenzamide |
| SMILES | CCC(NCCc1ccc(C(=O)N(C)CC(C)OC)cc1)C(O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C23H32ClN3O3/c1-5-20(22(28)19-10-11-21(24)26-14-19)25-13-12-17-6-8-18(9-7-17)23(29)27(3)15-16(2)30-4/h6-11,14,16,20,22,25,28H,5,12-13,15H2,1-4H3 |
| InChIKey | LZIYTZXQAFKZCT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|