C15H16Cl2N2O2 — CID 87675015
4-[2-[[(2S)-2-(5,6-dichloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenol (PubChem CID 87675015) has the molecular formula C15H16Cl2N2O2 and a molecular weight of 327.21 g/mol. Its IUPAC name is 4-[2-[[(2S)-2-(5,6-dichloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[(2S)-2-(5,6-dichloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 87675015 |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 4-[2-[[(2S)-2-(5,6-dichloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenol |
| SMILES | Oc1ccc(CCNC[C@@H](O)c2cnc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H16Cl2N2O2/c16-13-7-11(8-19-15(13)17)14(21)9-18-6-5-10-1-3-12(20)4-2-10/h1-4,7-8,14,18,20-21H,5-6,9H2/t14-/m1/s1 |
| InChIKey | PPNRYUWZDHWWNW-CQSZACIVSA-N |
| XLogP | 2.96 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|