C17H18Cl2N2O2 — CID 87947559
(7S)-7-[[(2S)-2-(5,6-dichloro-3-pyridinyl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 87947559) has the molecular formula C17H18Cl2N2O2 and a molecular weight of 353.25 g/mol. Its IUPAC name is (7S)-7-[[(2S)-2-(5,6-dichloro-3-pyridinyl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (7S)-7-[[(2S)-2-(5,6-dichloro-3-pyridinyl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 87947559 |
| Molecular Formula | C17H18Cl2N2O2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | (7S)-7-[[(2S)-2-(5,6-dichloro-3-pyridinyl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | Oc1ccc2c(c1)C[C@@H](NC[C@@H](O)c1cnc(Cl)c(Cl)c1)CC2 |
| InChI | InChI=1S/C17H18Cl2N2O2/c18-15-7-12(8-21-17(15)19)16(23)9-20-13-3-1-10-2-4-14(22)6-11(10)5-13/h2,4,6-8,13,16,20,22-23H,1,3,5,9H2/t13-,16+/m0/s1 |
| InChIKey | WWWJOFAHTGMLPY-XJKSGUPXSA-N |
| XLogP | 3.27 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|