C20H21F3N2O6 — CID 70045446
(2R)-2-amino-2-anilino-5-oxo-5-phenylmethoxypentanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 70045446) has the molecular formula C20H21F3N2O6 and a molecular weight of 442.39 g/mol. Its IUPAC name is (2R)-2-amino-2-anilino-5-oxo-5-phenylmethoxypentanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2R)-2-amino-2-anilino-5-oxo-5-phenylmethoxypentanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70045446 |
| Molecular Formula | C20H21F3N2O6 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | (2R)-2-amino-2-anilino-5-oxo-5-phenylmethoxypentanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | N[C@](CCC(=O)OCc1ccccc1)(Nc1ccccc1)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H20N2O4.C2HF3O2/c19-18(17(22)23,20-15-9-5-2-6-10-15)12-11-16(21)24-13-14-7-3-1-4-8-14;3-2(4,5)1(6)7/h1-10,20H,11-13,19H2,(H,22,23);(H,6,7)/t18-;/m1./s1 |
| InChIKey | JRKORTYTOWPVQD-GMUIIQOCSA-N |
| XLogP | 2.99 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|