C15H20ClF3N2O3 — CID 69483469
benzyl (2S)-2,6-diamino-8,8,8-trifluoro-7-oxooctanoate;hydrochloride (PubChem CID 69483469) has the molecular formula C15H20ClF3N2O3 and a molecular weight of 368.78 g/mol. Its IUPAC name is benzyl (2S)-2,6-diamino-8,8,8-trifluoro-7-oxooctanoate;hydrochloride.
| Compound Name | benzyl (2S)-2,6-diamino-8,8,8-trifluoro-7-oxooctanoate;hydrochloride |
|---|---|
| PubChem CID | 69483469 |
| Molecular Formula | C15H20ClF3N2O3 |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | benzyl (2S)-2,6-diamino-8,8,8-trifluoro-7-oxooctanoate;hydrochloride |
| SMILES | Cl.NC(CCC[C@H](N)C(=O)OCc1ccccc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H19F3N2O3.ClH/c16-15(17,18)13(21)11(19)7-4-8-12(20)14(22)23-9-10-5-2-1-3-6-10;/h1-3,5-6,11-12H,4,7-9,19-20H2;1H/t11?,12-;/m0./s1 |
| InChIKey | RFVPEKMLCJKTIS-MMFRDWCLSA-N |
| XLogP | 2.11 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |