C18H29N3O3S — CID 169041284
2-[[(2R)-2,6-diaminohexanoyl]amino]ethyl 4-phenylsulfanylbutanoate (PubChem CID 169041284) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is 2-[[(2R)-2,6-diaminohexanoyl]amino]ethyl 4-phenylsulfanylbutanoate.
| Compound Name | 2-[[(2R)-2,6-diaminohexanoyl]amino]ethyl 4-phenylsulfanylbutanoate |
|---|---|
| PubChem CID | 169041284 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-[[(2R)-2,6-diaminohexanoyl]amino]ethyl 4-phenylsulfanylbutanoate |
| SMILES | NCCCC[C@@H](N)C(=O)NCCOC(=O)CCCSc1ccccc1 |
| InChI | InChI=1S/C18H29N3O3S/c19-11-5-4-9-16(20)18(23)21-12-13-24-17(22)10-6-14-25-15-7-2-1-3-8-15/h1-3,7-8,16H,4-6,9-14,19-20H2,(H,21,23)/t16-/m1/s1 |
| InChIKey | HVJAJRPFMKTRFH-MRXNPFEDSA-N |
| XLogP | 1.67 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|