C10H17N3O2 — CID 106235864
2-amino-N-(5-amino-5-oxopentyl)pent-4-ynamide (PubChem CID 106235864) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-amino-N-(5-amino-5-oxopentyl)pent-4-ynamide.
| Compound Name | 2-amino-N-(5-amino-5-oxopentyl)pent-4-ynamide |
|---|---|
| PubChem CID | 106235864 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2-amino-N-(5-amino-5-oxopentyl)pent-4-ynamide |
| SMILES | C#CCC(N)C(=O)NCCCCC(N)=O |
| InChI | InChI=1S/C10H17N3O2/c1-2-5-8(11)10(15)13-7-4-3-6-9(12)14/h1,8H,3-7,11H2,(H2,12,14)(H,13,15) |
| InChIKey | STDXNLRBFVGUQK-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|