C12H25N3O3 — CID 113405165
3-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]-4,4-dimethylpentanamide (PubChem CID 113405165) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]-4,4-dimethylpentanamide.
| Compound Name | 3-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 113405165 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 3-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]-4,4-dimethylpentanamide |
| SMILES | COCCNC(=O)CNC(=O)CC(N)C(C)(C)C |
| InChI | InChI=1S/C12H25N3O3/c1-12(2,3)9(13)7-10(16)15-8-11(17)14-5-6-18-4/h9H,5-8,13H2,1-4H3,(H,14,17)(H,15,16) |
| InChIKey | OCWDFQKQZIVXMT-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|