C16H29N3O4 — CID 103389660
tert-butyl N-[5-methoxy-4-[(5-methyl-1,2-oxazol-3-yl)methylamino]pentyl]carbamate (PubChem CID 103389660) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is tert-butyl N-[5-methoxy-4-[(5-methyl-1,2-oxazol-3-yl)methylamino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-methoxy-4-[(5-methyl-1,2-oxazol-3-yl)methylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 103389660 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | tert-butyl N-[5-methoxy-4-[(5-methyl-1,2-oxazol-3-yl)methylamino]pentyl]carbamate |
| SMILES | COCC(CCCNC(=O)OC(C)(C)C)NCc1cc(C)on1 |
| InChI | InChI=1S/C16H29N3O4/c1-12-9-14(19-23-12)10-18-13(11-21-5)7-6-8-17-15(20)22-16(2,3)4/h9,13,18H,6-8,10-11H2,1-5H3,(H,17,20) |
| InChIKey | LSENIVJKDXQLAX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|