C15H27N3O4 — CID 106415302
tert-butyl N-[5-methoxy-4-(1,2-oxazol-5-ylmethylamino)pentyl]carbamate (PubChem CID 106415302) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is tert-butyl N-[5-methoxy-4-(1,2-oxazol-5-ylmethylamino)pentyl]carbamate.
| Compound Name | tert-butyl N-[5-methoxy-4-(1,2-oxazol-5-ylmethylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 106415302 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | tert-butyl N-[5-methoxy-4-(1,2-oxazol-5-ylmethylamino)pentyl]carbamate |
| SMILES | COCC(CCCNC(=O)OC(C)(C)C)NCc1ccno1 |
| InChI | InChI=1S/C15H27N3O4/c1-15(2,3)21-14(19)16-8-5-6-12(11-20-4)17-10-13-7-9-18-22-13/h7,9,12,17H,5-6,8,10-11H2,1-4H3,(H,16,19) |
| InChIKey | IPCVGKGQMHWJKM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|