C15H27N3O4S — CID 106380121
tert-butyl N-[5-methoxy-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pentyl]carbamate (PubChem CID 106380121) has the molecular formula C15H27N3O4S and a molecular weight of 345.47 g/mol. Its IUPAC name is tert-butyl N-[5-methoxy-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-methoxy-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 106380121 |
| Molecular Formula | C15H27N3O4S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | tert-butyl N-[5-methoxy-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pentyl]carbamate |
| SMILES | COCC(CCCNC(=O)OC(C)(C)C)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C15H27N3O4S/c1-15(2,3)22-13(19)16-7-5-6-11(9-21-4)17-8-12-10-23-14(20)18-12/h10-11,17H,5-9H2,1-4H3,(H,16,19)(H,18,20) |
| InChIKey | KXLBNSZHOZEMQT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|