C15H29N7O2 — CID 111887301
tert-butyl N-[3-[[N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate (PubChem CID 111887301) has the molecular formula C15H29N7O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111887301 |
| Molecular Formula | C15H29N7O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | tert-butyl N-[3-[[N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
| SMILES | CCn1cnnc1CN/C(=N/C)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29N7O2/c1-6-22-11-20-21-12(22)10-19-13(16-5)17-8-7-9-18-14(23)24-15(2,3)4/h11H,6-10H2,1-5H3,(H,18,23)(H2,16,17,19) |
| InChIKey | MTLXRECETUUMOP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|