C16H23FN6S — CID 111311086
1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine (PubChem CID 111311086) has the molecular formula C16H23FN6S and a molecular weight of 350.47 g/mol. Its IUPAC name is 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine.
| Compound Name | 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111311086 |
| Molecular Formula | C16H23FN6S |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine |
| SMILES | CCn1cnnc1CN/C(=N\C)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C16H23FN6S/c1-3-23-12-21-22-15(23)11-20-16(18-2)19-9-4-10-24-14-7-5-13(17)6-8-14/h5-8,12H,3-4,9-11H2,1-2H3,(H2,18,19,20) |
| InChIKey | PFAOBTRVPGAZBM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|