C17H26N4 — CID 103777679
N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-phenylhexan-1-amine (PubChem CID 103777679) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-phenylhexan-1-amine.
| Compound Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-phenylhexan-1-amine |
|---|---|
| PubChem CID | 103777679 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-phenylhexan-1-amine |
| SMILES | CCCCCC(NCc1nncn1CC)c1ccccc1 |
| InChI | InChI=1S/C17H26N4/c1-3-5-7-12-16(15-10-8-6-9-11-15)18-13-17-20-19-14-21(17)4-2/h6,8-11,14,16,18H,3-5,7,12-13H2,1-2H3 |
| InChIKey | WKILRZXDVNBGKT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|