C21H25N5O — CID 51122173
1-(1,3-diphenylpropyl)-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]urea (PubChem CID 51122173) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 1-(1,3-diphenylpropyl)-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]urea.
| Compound Name | 1-(1,3-diphenylpropyl)-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 51122173 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 1-(1,3-diphenylpropyl)-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]urea |
| SMILES | CCn1cnnc1CNC(=O)NC(CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25N5O/c1-2-26-16-23-25-20(26)15-22-21(27)24-19(18-11-7-4-8-12-18)14-13-17-9-5-3-6-10-17/h3-12,16,19H,2,13-15H2,1H3,(H2,22,24,27) |
| InChIKey | JRVXYGWRJFZTSC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |