C13H27N3O2 — CID 77055856
N-(3-ethylpentan-3-yl)-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide (PubChem CID 77055856) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is N-(3-ethylpentan-3-yl)-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide.
| Compound Name | N-(3-ethylpentan-3-yl)-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 77055856 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | N-(3-ethylpentan-3-yl)-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide |
| SMILES | CCC(CC)(CC)NC(=O)C(C(N)=NO)C(C)C |
| InChI | InChI=1S/C13H27N3O2/c1-6-13(7-2,8-3)15-12(17)10(9(4)5)11(14)16-18/h9-10,18H,6-8H2,1-5H3,(H2,14,16)(H,15,17) |
| InChIKey | ZZOYPEHCRLWOFE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|