C10H21NO3S — CID 116611382
5-amino-6,6-dimethyl-1-methylsulfonylheptan-4-one (PubChem CID 116611382) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is 5-amino-6,6-dimethyl-1-methylsulfonylheptan-4-one.
| Compound Name | 5-amino-6,6-dimethyl-1-methylsulfonylheptan-4-one |
|---|---|
| PubChem CID | 116611382 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 5-amino-6,6-dimethyl-1-methylsulfonylheptan-4-one |
| SMILES | CC(C)(C)C(N)C(=O)CCCS(C)(=O)=O |
| InChI | InChI=1S/C10H21NO3S/c1-10(2,3)9(11)8(12)6-5-7-15(4,13)14/h9H,5-7,11H2,1-4H3 |
| InChIKey | QXLABDOEWKZLJB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |