C9H18O3S — CID 61057918
2,2-dimethyl-6-methylsulfonylhexan-3-one (PubChem CID 61057918) has the molecular formula C9H18O3S and a molecular weight of 206.31 g/mol. Its IUPAC name is 2,2-dimethyl-6-methylsulfonylhexan-3-one.
| Compound Name | 2,2-dimethyl-6-methylsulfonylhexan-3-one |
|---|---|
| PubChem CID | 61057918 |
| Molecular Formula | C9H18O3S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 2,2-dimethyl-6-methylsulfonylhexan-3-one |
| SMILES | CC(C)(C)C(=O)CCCS(C)(=O)=O |
| InChI | InChI=1S/C9H18O3S/c1-9(2,3)8(10)6-5-7-13(4,11)12/h5-7H2,1-4H3 |
| InChIKey | HTRYOVCYDRFVSL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |