C14H30ClN3O2 — CID 119728295
(2S)-2-amino-N-[4-(diethylamino)-4-oxobutyl]-3,3-dimethylbutanamide;hydrochloride (PubChem CID 119728295) has the molecular formula C14H30ClN3O2 and a molecular weight of 307.87 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-(diethylamino)-4-oxobutyl]-3,3-dimethylbutanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[4-(diethylamino)-4-oxobutyl]-3,3-dimethylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119728295 |
| Molecular Formula | C14H30ClN3O2 |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (2S)-2-amino-N-[4-(diethylamino)-4-oxobutyl]-3,3-dimethylbutanamide;hydrochloride |
| SMILES | CCN(CC)C(=O)CCCNC(=O)[C@@H](N)C(C)(C)C.Cl |
| InChI | InChI=1S/C14H29N3O2.ClH/c1-6-17(7-2)11(18)9-8-10-16-13(19)12(15)14(3,4)5;/h12H,6-10,15H2,1-5H3,(H,16,19);1H/t12-;/m1./s1 |
| InChIKey | VZUNSCGJACVUTR-UTONKHPSSA-N |
| XLogP | 1.55 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|