C15H31N5O3 — CID 150499844
tert-butyl N-[[6-[(2-aminoacetyl)amino]hexylamino]-(methylideneamino)methyl]carbamate (PubChem CID 150499844) has the molecular formula C15H31N5O3 and a molecular weight of 329.45 g/mol. Its IUPAC name is tert-butyl N-[[6-[(2-aminoacetyl)amino]hexylamino]-(methylideneamino)methyl]carbamate.
| Compound Name | tert-butyl N-[[6-[(2-aminoacetyl)amino]hexylamino]-(methylideneamino)methyl]carbamate |
|---|---|
| PubChem CID | 150499844 |
| Molecular Formula | C15H31N5O3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | tert-butyl N-[[6-[(2-aminoacetyl)amino]hexylamino]-(methylideneamino)methyl]carbamate |
| SMILES | C=NC(NCCCCCCNC(=O)CN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H31N5O3/c1-15(2,3)23-14(22)20-13(17-4)19-10-8-6-5-7-9-18-12(21)11-16/h13,19H,4-11,16H2,1-3H3,(H,18,21)(H,20,22) |
| InChIKey | HXOSLSXXQPHTIG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|