C16H29N3O5 — CID 59903305
(methylideneamino) (2S)-2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]butanoate (PubChem CID 59903305) has the molecular formula C16H29N3O5 and a molecular weight of 343.42 g/mol. Its IUPAC name is (methylideneamino) (2S)-2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]butanoate.
| Compound Name | (methylideneamino) (2S)-2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]butanoate |
|---|---|
| PubChem CID | 59903305 |
| Molecular Formula | C16H29N3O5 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (methylideneamino) (2S)-2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]butanoate |
| SMILES | C=NOC(=O)[C@H](CC)NC(=O)CCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29N3O5/c1-6-12(14(21)24-17-5)19-13(20)10-8-7-9-11-18-15(22)23-16(2,3)4/h12H,5-11H2,1-4H3,(H,18,22)(H,19,20)/t12-/m0/s1 |
| InChIKey | IHYOIJBBVNPYFU-LBPRGKRZSA-N |
| XLogP | 2.13 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|