C8H18N4O2 — CID 63573846
2-[(1-hydrazinyl-3-methyl-1-oxobutan-2-yl)-methylamino]acetamide (PubChem CID 63573846) has the molecular formula C8H18N4O2 and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-[(1-hydrazinyl-3-methyl-1-oxobutan-2-yl)-methylamino]acetamide.
| Compound Name | 2-[(1-hydrazinyl-3-methyl-1-oxobutan-2-yl)-methylamino]acetamide |
|---|---|
| PubChem CID | 63573846 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2-[(1-hydrazinyl-3-methyl-1-oxobutan-2-yl)-methylamino]acetamide |
| SMILES | CC(C)C(C(=O)NN)N(C)CC(N)=O |
| InChI | InChI=1S/C8H18N4O2/c1-5(2)7(8(14)11-10)12(3)4-6(9)13/h5,7H,4,10H2,1-3H3,(H2,9,13)(H,11,14) |
| InChIKey | CLOXPVQCFYFOTE-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|