C8H19N3O2 — CID 63572653
2-[2-hydroxyethyl(methyl)amino]-3-methylbutanehydrazide (PubChem CID 63572653) has the molecular formula C8H19N3O2 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(methyl)amino]-3-methylbutanehydrazide.
| Compound Name | 2-[2-hydroxyethyl(methyl)amino]-3-methylbutanehydrazide |
|---|---|
| PubChem CID | 63572653 |
| Molecular Formula | C8H19N3O2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2-[2-hydroxyethyl(methyl)amino]-3-methylbutanehydrazide |
| SMILES | CC(C)C(C(=O)NN)N(C)CCO |
| InChI | InChI=1S/C8H19N3O2/c1-6(2)7(8(13)10-9)11(3)4-5-12/h6-7,12H,4-5,9H2,1-3H3,(H,10,13) |
| InChIKey | TXUDWRWVWMGCJH-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|