C7H17N3O3 — CID 103229552
2-[2-hydroxyethyl(methyl)amino]-3-methoxypropanehydrazide (PubChem CID 103229552) has the molecular formula C7H17N3O3 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(methyl)amino]-3-methoxypropanehydrazide.
| Compound Name | 2-[2-hydroxyethyl(methyl)amino]-3-methoxypropanehydrazide |
|---|---|
| PubChem CID | 103229552 |
| Molecular Formula | C7H17N3O3 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-[2-hydroxyethyl(methyl)amino]-3-methoxypropanehydrazide |
| SMILES | COCC(C(=O)NN)N(C)CCO |
| InChI | InChI=1S/C7H17N3O3/c1-10(3-4-11)6(5-13-2)7(12)9-8/h6,11H,3-5,8H2,1-2H3,(H,9,12) |
| InChIKey | MNIVEZYKXOGOOR-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|