C9H21N3O3 — CID 103229639
2-[ethyl(2-methoxyethyl)amino]-3-methoxypropanehydrazide (PubChem CID 103229639) has the molecular formula C9H21N3O3 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-[ethyl(2-methoxyethyl)amino]-3-methoxypropanehydrazide.
| Compound Name | 2-[ethyl(2-methoxyethyl)amino]-3-methoxypropanehydrazide |
|---|---|
| PubChem CID | 103229639 |
| Molecular Formula | C9H21N3O3 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2-[ethyl(2-methoxyethyl)amino]-3-methoxypropanehydrazide |
| SMILES | CCN(CCOC)C(COC)C(=O)NN |
| InChI | InChI=1S/C9H21N3O3/c1-4-12(5-6-14-2)8(7-15-3)9(13)11-10/h8H,4-7,10H2,1-3H3,(H,11,13) |
| InChIKey | CJWFOEOJVIWMJS-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|