C12H27N3O2 — CID 79408378
3-[butan-2-yl(2-methoxyethyl)amino]-2-methylbutanehydrazide (PubChem CID 79408378) has the molecular formula C12H27N3O2 and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-[butan-2-yl(2-methoxyethyl)amino]-2-methylbutanehydrazide.
| Compound Name | 3-[butan-2-yl(2-methoxyethyl)amino]-2-methylbutanehydrazide |
|---|---|
| PubChem CID | 79408378 |
| Molecular Formula | C12H27N3O2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 3-[butan-2-yl(2-methoxyethyl)amino]-2-methylbutanehydrazide |
| SMILES | CCC(C)N(CCOC)C(C)C(C)C(=O)NN |
| InChI | InChI=1S/C12H27N3O2/c1-6-9(2)15(7-8-17-5)11(4)10(3)12(16)14-13/h9-11H,6-8,13H2,1-5H3,(H,14,16) |
| InChIKey | WQNIXRAZTGYADX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|