C8H18N4O3 — CID 103229508
2-[(1-hydrazinyl-3-methoxy-1-oxopropan-2-yl)-methylamino]-N-methylacetamide (PubChem CID 103229508) has the molecular formula C8H18N4O3 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-[(1-hydrazinyl-3-methoxy-1-oxopropan-2-yl)-methylamino]-N-methylacetamide.
| Compound Name | 2-[(1-hydrazinyl-3-methoxy-1-oxopropan-2-yl)-methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 103229508 |
| Molecular Formula | C8H18N4O3 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-[(1-hydrazinyl-3-methoxy-1-oxopropan-2-yl)-methylamino]-N-methylacetamide |
| SMILES | CNC(=O)CN(C)C(COC)C(=O)NN |
| InChI | InChI=1S/C8H18N4O3/c1-10-7(13)4-12(2)6(5-15-3)8(14)11-9/h6H,4-5,9H2,1-3H3,(H,10,13)(H,11,14) |
| InChIKey | CJHGCIPHQLLZLJ-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|