C7H17N3O2 — CID 63585055
2-[1-methoxypropan-2-yl(methyl)amino]acetohydrazide (PubChem CID 63585055) has the molecular formula C7H17N3O2 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-[1-methoxypropan-2-yl(methyl)amino]acetohydrazide.
| Compound Name | 2-[1-methoxypropan-2-yl(methyl)amino]acetohydrazide |
|---|---|
| PubChem CID | 63585055 |
| Molecular Formula | C7H17N3O2 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.13 |
| IUPAC Name | 2-[1-methoxypropan-2-yl(methyl)amino]acetohydrazide |
| SMILES | COCC(C)N(C)CC(=O)NN |
| InChI | InChI=1S/C7H17N3O2/c1-6(5-12-3)10(2)4-7(11)9-8/h6H,4-5,8H2,1-3H3,(H,9,11) |
| InChIKey | NBODTXSFROBYFS-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|