C9H21N3O4 — CID 103229676
2-[(2-hydroxy-3-methoxypropyl)-methylamino]-3-methoxypropanehydrazide (PubChem CID 103229676) has the molecular formula C9H21N3O4 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-[(2-hydroxy-3-methoxypropyl)-methylamino]-3-methoxypropanehydrazide.
| Compound Name | 2-[(2-hydroxy-3-methoxypropyl)-methylamino]-3-methoxypropanehydrazide |
|---|---|
| PubChem CID | 103229676 |
| Molecular Formula | C9H21N3O4 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 2-[(2-hydroxy-3-methoxypropyl)-methylamino]-3-methoxypropanehydrazide |
| SMILES | COCC(O)CN(C)C(COC)C(=O)NN |
| InChI | InChI=1S/C9H21N3O4/c1-12(4-7(13)5-15-2)8(6-16-3)9(14)11-10/h7-8,13H,4-6,10H2,1-3H3,(H,11,14) |
| InChIKey | HSCWXVVFXQFJMI-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|