C9H19NO5 — CID 103224662
2-[(2-hydroxy-3-methoxypropyl)-methylamino]-3-methoxypropanoic acid (PubChem CID 103224662) has the molecular formula C9H19NO5 and a molecular weight of 221.25 g/mol. Its IUPAC name is 2-[(2-hydroxy-3-methoxypropyl)-methylamino]-3-methoxypropanoic acid.
| Compound Name | 2-[(2-hydroxy-3-methoxypropyl)-methylamino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 103224662 |
| Molecular Formula | C9H19NO5 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 2-[(2-hydroxy-3-methoxypropyl)-methylamino]-3-methoxypropanoic acid |
| SMILES | COCC(O)CN(C)C(COC)C(=O)O |
| InChI | InChI=1S/C9H19NO5/c1-10(4-7(11)5-14-2)8(6-15-3)9(12)13/h7-8,11H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | LLWCDTCVENEDSG-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |