C10H23N3O3 — CID 103229681
2-[3-hydroxypropyl(propan-2-yl)amino]-3-methoxypropanehydrazide (PubChem CID 103229681) has the molecular formula C10H23N3O3 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-[3-hydroxypropyl(propan-2-yl)amino]-3-methoxypropanehydrazide.
| Compound Name | 2-[3-hydroxypropyl(propan-2-yl)amino]-3-methoxypropanehydrazide |
|---|---|
| PubChem CID | 103229681 |
| Molecular Formula | C10H23N3O3 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.17 |
| IUPAC Name | 2-[3-hydroxypropyl(propan-2-yl)amino]-3-methoxypropanehydrazide |
| SMILES | COCC(C(=O)NN)N(CCCO)C(C)C |
| InChI | InChI=1S/C10H23N3O3/c1-8(2)13(5-4-6-14)9(7-16-3)10(15)12-11/h8-9,14H,4-7,11H2,1-3H3,(H,12,15) |
| InChIKey | UBNKQWLQGSLAAW-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|