C11H21N3O5 — CID 106109940
3-[[ethyl-[2-(ethylamino)-2-oxoethyl]carbamoyl]amino]-2-methoxypropanoic acid (PubChem CID 106109940) has the molecular formula C11H21N3O5 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-[[ethyl-[2-(ethylamino)-2-oxoethyl]carbamoyl]amino]-2-methoxypropanoic acid.
| Compound Name | 3-[[ethyl-[2-(ethylamino)-2-oxoethyl]carbamoyl]amino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 106109940 |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3-[[ethyl-[2-(ethylamino)-2-oxoethyl]carbamoyl]amino]-2-methoxypropanoic acid |
| SMILES | CCNC(=O)CN(CC)C(=O)NCC(OC)C(=O)O |
| InChI | InChI=1S/C11H21N3O5/c1-4-12-9(15)7-14(5-2)11(18)13-6-8(19-3)10(16)17/h8H,4-7H2,1-3H3,(H,12,15)(H,13,18)(H,16,17) |
| InChIKey | XNDINQFTRRWAQE-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |