C13H25N3O4 — CID 65220926
2-[[[ethyl-[2-(ethylamino)-2-oxoethyl]carbamoyl]amino]methyl]pentanoic acid (PubChem CID 65220926) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[[[ethyl-[2-(ethylamino)-2-oxoethyl]carbamoyl]amino]methyl]pentanoic acid.
| Compound Name | 2-[[[ethyl-[2-(ethylamino)-2-oxoethyl]carbamoyl]amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 65220926 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 2-[[[ethyl-[2-(ethylamino)-2-oxoethyl]carbamoyl]amino]methyl]pentanoic acid |
| SMILES | CCCC(CNC(=O)N(CC)CC(=O)NCC)C(=O)O |
| InChI | InChI=1S/C13H25N3O4/c1-4-7-10(12(18)19)8-15-13(20)16(6-3)9-11(17)14-5-2/h10H,4-9H2,1-3H3,(H,14,17)(H,15,20)(H,18,19) |
| InChIKey | DLVGQAASVXQINH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |