C9H16N4O6 — CID 114144690
3-[bis(2-amino-2-oxoethyl)carbamoylamino]-2-methoxypropanoic acid (PubChem CID 114144690) has the molecular formula C9H16N4O6 and a molecular weight of 276.25 g/mol. Its IUPAC name is 3-[bis(2-amino-2-oxoethyl)carbamoylamino]-2-methoxypropanoic acid.
| Compound Name | 3-[bis(2-amino-2-oxoethyl)carbamoylamino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 114144690 |
| Molecular Formula | C9H16N4O6 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-[bis(2-amino-2-oxoethyl)carbamoylamino]-2-methoxypropanoic acid |
| SMILES | COC(CNC(=O)N(CC(N)=O)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H16N4O6/c1-19-5(8(16)17)2-12-9(18)13(3-6(10)14)4-7(11)15/h5H,2-4H2,1H3,(H2,10,14)(H2,11,15)(H,12,18)(H,16,17) |
| InChIKey | RZSCNBKBSAVDAT-UHFFFAOYSA-N |
| XLogP | -2.93 |
| TPSA | 165.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |