About 3-methoxy-2-[propyl(2,2,2-trifluoroethyl)amino]propanoic acid
3-methoxy-2-[propyl(2,2,2-trifluoroethyl)amino]propanoic acid (PubChem CID 103224693) has the molecular formula C9H16F3NO3
and a molecular weight of 243.22 g/mol. Its IUPAC name is 3-methoxy-2-[propyl(2,2,2-trifluoroethyl)amino]propanoic acid.
Analyze 3-methoxy-2-[propyl(2,2,2-trifluoroethyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2-[propyl(2,2,2-trifluoroethyl)amino]propanoic acid?
The IUPAC name of 3-methoxy-2-[propyl(2,2,2-trifluoroethyl)amino]propanoic acid (CID 103224693) is 3-methoxy-2-[propyl(2,2,2-trifluoroethyl)amino]propanoic acid.
What is the SMILES notation for 3-methoxy-2-[propyl(2,2,2-trifluoroethyl)amino]propanoic acid?
The canonical SMILES for 3-methoxy-2-[propyl(2,2,2-trifluoroethyl)amino]propanoic acid is CCCN(CC(F)(F)F)C(COC)C(=O)O.
What is the InChIKey of 3-methoxy-2-[propyl(2,2,2-trifluoroethyl)amino]propanoic acid?
The InChIKey is QMHDCYMKNZVOAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO3/c1-3-4-13(6-9(10,11)12)7(5-16-2)8(14)15/h7H,3-6H2,1-2H3,(H,14,15).
What are the key properties of 3-methoxy-2-[propyl(2,2,2-trifluoroethyl)amino]propanoic acid?
3-methoxy-2-[propyl(2,2,2-trifluoroethyl)amino]propanoic acid has a molecular weight of 243.22 g/mol, XLogP of 1.36, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2-[propyl(2,2,2-trifluoroethyl)amino]propanoic acid is sourced from PubChem (CID 103224693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).