C8H15F3N2O2 — CID 64693783
4-amino-2-[ethyl(2,2,2-trifluoroethyl)amino]butanoic acid (PubChem CID 64693783) has the molecular formula C8H15F3N2O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is 4-amino-2-[ethyl(2,2,2-trifluoroethyl)amino]butanoic acid.
| Compound Name | 4-amino-2-[ethyl(2,2,2-trifluoroethyl)amino]butanoic acid |
|---|---|
| PubChem CID | 64693783 |
| Molecular Formula | C8H15F3N2O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 4-amino-2-[ethyl(2,2,2-trifluoroethyl)amino]butanoic acid |
| SMILES | CCN(CC(F)(F)F)C(CCN)C(=O)O |
| InChI | InChI=1S/C8H15F3N2O2/c1-2-13(5-8(9,10)11)6(3-4-12)7(14)15/h6H,2-5,12H2,1H3,(H,14,15) |
| InChIKey | ASRHPQRZFVYRNC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |