C14H18F3NO — CID 55010357
2-[ethyl(2,2,2-trifluoroethyl)amino]-1-phenylbutan-1-one (PubChem CID 55010357) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-[ethyl(2,2,2-trifluoroethyl)amino]-1-phenylbutan-1-one.
| Compound Name | 2-[ethyl(2,2,2-trifluoroethyl)amino]-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 55010357 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-[ethyl(2,2,2-trifluoroethyl)amino]-1-phenylbutan-1-one |
| SMILES | CCC(C(=O)c1ccccc1)N(CC)CC(F)(F)F |
| InChI | InChI=1S/C14H18F3NO/c1-3-12(18(4-2)10-14(15,16)17)13(19)11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3 |
| InChIKey | YJDOELRXAHBOJP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |