C9H20N2O3 — CID 61072169
2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetamide (PubChem CID 61072169) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetamide.
| Compound Name | 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 61072169 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetamide |
| SMILES | COCCN(CC(N)=O)C(C)COC |
| InChI | InChI=1S/C9H20N2O3/c1-8(7-14-3)11(4-5-13-2)6-9(10)12/h8H,4-7H2,1-3H3,(H2,10,12) |
| InChIKey | NWXYFGKELAQJJG-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |