C10H16N2O2 — CID 156818276
3-[2-[methyl(propyl)amino]ethylamino]cyclobut-3-ene-1,2-dione (PubChem CID 156818276) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-[2-[methyl(propyl)amino]ethylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[2-[methyl(propyl)amino]ethylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 156818276 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 3-[2-[methyl(propyl)amino]ethylamino]cyclobut-3-ene-1,2-dione |
| SMILES | CCCN(C)CCNc1cc(=O)c1=O |
| InChI | InChI=1S/C10H16N2O2/c1-3-5-12(2)6-4-11-8-7-9(13)10(8)14/h7,11H,3-6H2,1-2H3 |
| InChIKey | NPSUJPDBDCBWTD-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|