C16H14F4N2O2 — CID 170438026
2-(4-fluoro-2-prop-2-enylanilino)-2-(trifluoromethyl)-3H-pyridine-4-carboxylic acid (PubChem CID 170438026) has the molecular formula C16H14F4N2O2 and a molecular weight of 342.29 g/mol. Its IUPAC name is 2-(4-fluoro-2-prop-2-enylanilino)-2-(trifluoromethyl)-3H-pyridine-4-carboxylic acid.
| Compound Name | 2-(4-fluoro-2-prop-2-enylanilino)-2-(trifluoromethyl)-3H-pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 170438026 |
| Molecular Formula | C16H14F4N2O2 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-(4-fluoro-2-prop-2-enylanilino)-2-(trifluoromethyl)-3H-pyridine-4-carboxylic acid |
| SMILES | C=CCc1cc(F)ccc1NC1(C(F)(F)F)CC(C(=O)O)=CC=N1 |
| InChI | InChI=1S/C16H14F4N2O2/c1-2-3-10-8-12(17)4-5-13(10)22-15(16(18,19)20)9-11(14(23)24)6-7-21-15/h2,4-8,22H,1,3,9H2,(H,23,24) |
| InChIKey | UJKHSXSWNQKRIA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|