C20H22F4N2O3S — CID 133326397
1-[[2-[[4-fluoro-2-(trifluoromethylsulfonyl)anilino]methyl]phenyl]methyl]piperidin-4-ol (PubChem CID 133326397) has the molecular formula C20H22F4N2O3S and a molecular weight of 446.47 g/mol. Its IUPAC name is 1-[[2-[[4-fluoro-2-(trifluoromethylsulfonyl)anilino]methyl]phenyl]methyl]piperidin-4-ol.
| Compound Name | 1-[[2-[[4-fluoro-2-(trifluoromethylsulfonyl)anilino]methyl]phenyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 133326397 |
| Molecular Formula | C20H22F4N2O3S |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 1-[[2-[[4-fluoro-2-(trifluoromethylsulfonyl)anilino]methyl]phenyl]methyl]piperidin-4-ol |
| SMILES | O=S(=O)(c1cc(F)ccc1NCc1ccccc1CN1CCC(O)CC1)C(F)(F)F |
| InChI | InChI=1S/C20H22F4N2O3S/c21-16-5-6-18(19(11-16)30(28,29)20(22,23)24)25-12-14-3-1-2-4-15(14)13-26-9-7-17(27)8-10-26/h1-6,11,17,25,27H,7-10,12-13H2 |
| InChIKey | OXTUUBBKBUEVPH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |