C20H25N3O4 — CID 133438068
1-[[2-[[5-(hydroxymethyl)-2-nitroanilino]methyl]phenyl]methyl]piperidin-4-ol (PubChem CID 133438068) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[[2-[[5-(hydroxymethyl)-2-nitroanilino]methyl]phenyl]methyl]piperidin-4-ol.
| Compound Name | 1-[[2-[[5-(hydroxymethyl)-2-nitroanilino]methyl]phenyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 133438068 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-[[2-[[5-(hydroxymethyl)-2-nitroanilino]methyl]phenyl]methyl]piperidin-4-ol |
| SMILES | O=[N+]([O-])c1ccc(CO)cc1NCc1ccccc1CN1CCC(O)CC1 |
| InChI | InChI=1S/C20H25N3O4/c24-14-15-5-6-20(23(26)27)19(11-15)21-12-16-3-1-2-4-17(16)13-22-9-7-18(25)8-10-22/h1-6,11,18,21,24-25H,7-10,12-14H2 |
| InChIKey | GEMVKGVORYIYJR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 98.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|