C12H13F4NO2S2 — CID 107296767
4-fluoro-N-(thiolan-3-ylmethyl)-2-(trifluoromethylsulfonyl)aniline (PubChem CID 107296767) has the molecular formula C12H13F4NO2S2 and a molecular weight of 343.37 g/mol. Its IUPAC name is 4-fluoro-N-(thiolan-3-ylmethyl)-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | 4-fluoro-N-(thiolan-3-ylmethyl)-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 107296767 |
| Molecular Formula | C12H13F4NO2S2 |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 4-fluoro-N-(thiolan-3-ylmethyl)-2-(trifluoromethylsulfonyl)aniline |
| SMILES | O=S(=O)(c1cc(F)ccc1NCC1CCSC1)C(F)(F)F |
| InChI | InChI=1S/C12H13F4NO2S2/c13-9-1-2-10(17-6-8-3-4-20-7-8)11(5-9)21(18,19)12(14,15)16/h1-2,5,8,17H,3-4,6-7H2 |
| InChIKey | JNTFKDMXZXCCFB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |