C16H20F4N2O2S — CID 133283522
1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-3-pyrrolidin-1-ylpiperidine (PubChem CID 133283522) has the molecular formula C16H20F4N2O2S and a molecular weight of 380.41 g/mol. Its IUPAC name is 1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-3-pyrrolidin-1-ylpiperidine.
| Compound Name | 1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-3-pyrrolidin-1-ylpiperidine |
|---|---|
| PubChem CID | 133283522 |
| Molecular Formula | C16H20F4N2O2S |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1-[4-fluoro-2-(trifluoromethylsulfonyl)phenyl]-3-pyrrolidin-1-ylpiperidine |
| SMILES | O=S(=O)(c1cc(F)ccc1N1CCCC(N2CCCC2)C1)C(F)(F)F |
| InChI | InChI=1S/C16H20F4N2O2S/c17-12-5-6-14(15(10-12)25(23,24)16(18,19)20)22-9-3-4-13(11-22)21-7-1-2-8-21/h5-6,10,13H,1-4,7-9,11H2 |
| InChIKey | OSCBUFQVVRFTGD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |