C11H12F3NO3S — CID 55132124
1-[2-(trifluoromethylsulfonyl)phenyl]pyrrolidin-3-ol (PubChem CID 55132124) has the molecular formula C11H12F3NO3S and a molecular weight of 295.28 g/mol. Its IUPAC name is 1-[2-(trifluoromethylsulfonyl)phenyl]pyrrolidin-3-ol.
| Compound Name | 1-[2-(trifluoromethylsulfonyl)phenyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 55132124 |
| Molecular Formula | C11H12F3NO3S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 1-[2-(trifluoromethylsulfonyl)phenyl]pyrrolidin-3-ol |
| SMILES | O=S(=O)(c1ccccc1N1CCC(O)C1)C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO3S/c12-11(13,14)19(17,18)10-4-2-1-3-9(10)15-6-5-8(16)7-15/h1-4,8,16H,5-7H2 |
| InChIKey | MGTLWCFMHVEBGG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |