C12H13BrF3NO2S — CID 80673575
3-bromo-1-[2-(trifluoromethylsulfonyl)phenyl]piperidine (PubChem CID 80673575) has the molecular formula C12H13BrF3NO2S and a molecular weight of 372.21 g/mol. Its IUPAC name is 3-bromo-1-[2-(trifluoromethylsulfonyl)phenyl]piperidine.
| Compound Name | 3-bromo-1-[2-(trifluoromethylsulfonyl)phenyl]piperidine |
|---|---|
| PubChem CID | 80673575 |
| Molecular Formula | C12H13BrF3NO2S |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 3-bromo-1-[2-(trifluoromethylsulfonyl)phenyl]piperidine |
| SMILES | O=S(=O)(c1ccccc1N1CCCC(Br)C1)C(F)(F)F |
| InChI | InChI=1S/C12H13BrF3NO2S/c13-9-4-3-7-17(8-9)10-5-1-2-6-11(10)20(18,19)12(14,15)16/h1-2,5-6,9H,3-4,7-8H2 |
| InChIKey | KOEAKTYJKJMLBR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|