C18H18F3NO3S — CID 133354177
2-(2-methylphenyl)-4-[2-(trifluoromethylsulfonyl)phenyl]morpholine (PubChem CID 133354177) has the molecular formula C18H18F3NO3S and a molecular weight of 385.41 g/mol. Its IUPAC name is 2-(2-methylphenyl)-4-[2-(trifluoromethylsulfonyl)phenyl]morpholine.
| Compound Name | 2-(2-methylphenyl)-4-[2-(trifluoromethylsulfonyl)phenyl]morpholine |
|---|---|
| PubChem CID | 133354177 |
| Molecular Formula | C18H18F3NO3S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-(2-methylphenyl)-4-[2-(trifluoromethylsulfonyl)phenyl]morpholine |
| SMILES | Cc1ccccc1C1CN(c2ccccc2S(=O)(=O)C(F)(F)F)CCO1 |
| InChI | InChI=1S/C18H18F3NO3S/c1-13-6-2-3-7-14(13)16-12-22(10-11-25-16)15-8-4-5-9-17(15)26(23,24)18(19,20)21/h2-9,16H,10-12H2,1H3 |
| InChIKey | BRLULBXNMQREAS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |