C17H21NO4S — CID 100665177
(2S)-4-(2-ethylsulfonylphenyl)-2-(5-methylfuran-2-yl)morpholine (PubChem CID 100665177) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is (2S)-4-(2-ethylsulfonylphenyl)-2-(5-methylfuran-2-yl)morpholine.
| Compound Name | (2S)-4-(2-ethylsulfonylphenyl)-2-(5-methylfuran-2-yl)morpholine |
|---|---|
| PubChem CID | 100665177 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (2S)-4-(2-ethylsulfonylphenyl)-2-(5-methylfuran-2-yl)morpholine |
| SMILES | CCS(=O)(=O)c1ccccc1N1CCO[C@H](c2ccc(C)o2)C1 |
| InChI | InChI=1S/C17H21NO4S/c1-3-23(19,20)17-7-5-4-6-14(17)18-10-11-21-16(12-18)15-9-8-13(2)22-15/h4-9,16H,3,10-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | VPUHGWBKSRNVOL-INIZCTEOSA-N |
| XLogP | 2.96 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |