C20H22N2O2 — CID 133451752
4-(2,3-dimethylquinolin-4-yl)-2-(5-methylfuran-2-yl)morpholine (PubChem CID 133451752) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-(2,3-dimethylquinolin-4-yl)-2-(5-methylfuran-2-yl)morpholine.
| Compound Name | 4-(2,3-dimethylquinolin-4-yl)-2-(5-methylfuran-2-yl)morpholine |
|---|---|
| PubChem CID | 133451752 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 4-(2,3-dimethylquinolin-4-yl)-2-(5-methylfuran-2-yl)morpholine |
| SMILES | Cc1ccc(C2CN(c3c(C)c(C)nc4ccccc34)CCO2)o1 |
| InChI | InChI=1S/C20H22N2O2/c1-13-8-9-18(24-13)19-12-22(10-11-23-19)20-14(2)15(3)21-17-7-5-4-6-16(17)20/h4-9,19H,10-12H2,1-3H3 |
| InChIKey | IFUBRAXKRJTFST-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |